C23H34N2O3 — CID 143017015
(2S)-2-amino-N-cyclobutyl-2-[4-[[3-(1-hydroxyethenyl)-5-methylphenoxy]methyl]cyclohexyl]-N-methylacetamide (PubChem CID 143017015) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclobutyl-2-[4-[[3-(1-hydroxyethenyl)-5-methylphenoxy]methyl]cyclohexyl]-N-methylacetamide.
| Compound Name | (2S)-2-amino-N-cyclobutyl-2-[4-[[3-(1-hydroxyethenyl)-5-methylphenoxy]methyl]cyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 143017015 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (2S)-2-amino-N-cyclobutyl-2-[4-[[3-(1-hydroxyethenyl)-5-methylphenoxy]methyl]cyclohexyl]-N-methylacetamide |
| SMILES | C=C(O)c1cc(C)cc(OCC2CCC([C@H](N)C(=O)N(C)C3CCC3)CC2)c1 |
| InChI | InChI=1S/C23H34N2O3/c1-15-11-19(16(2)26)13-21(12-15)28-14-17-7-9-18(10-8-17)22(24)23(27)25(3)20-5-4-6-20/h11-13,17-18,20,22,26H,2,4-10,14,24H2,1,3H3/t17?,18?,22-/m0/s1 |
| InChIKey | PTZWTRAAGBNMRR-IRZJEQJZSA-N |
| XLogP | 4.05 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|