About 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one
7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one (PubChem CID 143017382) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one.
Molecular Properties
| Compound Name | 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one |
| PubChem CID | 143017382 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one |
| SMILES | CC1C=Cc2cc[nH]c(=O)c2C=N1 |
| InChI | InChI=1S/C10H10N2O/c1-7-2-3-8-4-5-11-10(13)9(8)6-12-7/h2-7H,1H3,(H,11,13) |
| InChIKey | YVKLARIQVRWPJT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one?
The IUPAC name of 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one (CID 143017382) is 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one.
What is the SMILES notation for 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one?
The canonical SMILES for 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one is CC1C=Cc2cc[nH]c(=O)c2C=N1.
What is the InChIKey of 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one?
The InChIKey is YVKLARIQVRWPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-7-2-3-8-4-5-11-10(13)9(8)6-12-7/h2-7H,1H3,(H,11,13).
What are the key properties of 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one?
7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one has a molecular weight of 174.20 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,7-dihydropyrido[3,4-c]azepin-1-one is sourced from PubChem (CID 143017382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).