C15H27NO — CID 143017797
(3E,5Z,7E)-3,8-dimethyl-9-[methyl(propyl)amino]nona-3,5,7-trien-2-ol (PubChem CID 143017797) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (3E,5Z,7E)-3,8-dimethyl-9-[methyl(propyl)amino]nona-3,5,7-trien-2-ol.
| Compound Name | (3E,5Z,7E)-3,8-dimethyl-9-[methyl(propyl)amino]nona-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 143017797 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (3E,5Z,7E)-3,8-dimethyl-9-[methyl(propyl)amino]nona-3,5,7-trien-2-ol |
| SMILES | CCCN(C)C/C(C)=C/C=C\C=C(/C)C(C)O |
| InChI | InChI=1S/C15H27NO/c1-6-11-16(5)12-13(2)9-7-8-10-14(3)15(4)17/h7-10,15,17H,6,11-12H2,1-5H3/b8-7-,13-9+,14-10+ |
| InChIKey | FFBRCKZYFMXZKK-JQEWSGGFSA-N |
| XLogP | 3.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|