C23H44N8O2 — CID 143018114
3,5-diamino-N-[N'-[8-[2-(dimethylamino)ethoxy]-4,4,6,6-tetramethyloctyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide (PubChem CID 143018114) has the molecular formula C23H44N8O2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[8-[2-(dimethylamino)ethoxy]-4,4,6,6-tetramethyloctyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[8-[2-(dimethylamino)ethoxy]-4,4,6,6-tetramethyloctyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143018114 |
| Molecular Formula | C23H44N8O2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.36 |
| IUPAC Name | 3,5-diamino-N-[N'-[8-[2-(dimethylamino)ethoxy]-4,4,6,6-tetramethyloctyl]carbamimidoyl]-6-methylpyrazine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N/C(N)=N/CCCC(C)(C)CC(C)(C)CCOCCN(C)C)c(N)nc1N |
| InChI | InChI=1S/C23H44N8O2/c1-16-18(24)29-19(25)17(28-16)20(32)30-21(26)27-11-8-9-22(2,3)15-23(4,5)10-13-33-14-12-31(6)7/h8-15H2,1-7H3,(H4,24,25,29)(H3,26,27,30,32) |
| InChIKey | OAZUVQVUTOXBRE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|