C27H39N3O2 — CID 143018159
N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-4-heptylbenzamide (PubChem CID 143018159) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-4-heptylbenzamide.
| Compound Name | N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-4-heptylbenzamide |
|---|---|
| PubChem CID | 143018159 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-4-heptylbenzamide |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2ccc(C(=O)NCCN(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C27H39N3O2/c1-4-7-8-9-10-11-22-12-14-24(15-13-22)27(32)29-25-18-16-23(17-19-25)26(31)28-20-21-30(5-2)6-3/h12-19H,4-11,20-21H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | XVJUFXKHNOUQOI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|