About 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one
2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one (PubChem CID 143018685) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one |
| PubChem CID | 143018685 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one |
| SMILES | [H]/N=C/C(=O)c1cc(=O)c2cc(C)c(C)c(C)c2[nH]1 |
| InChI | InChI=1S/C14H14N2O2/c1-7-4-10-12(17)5-11(13(18)6-15)16-14(10)9(3)8(7)2/h4-6,15H,1-3H3,(H,16,17)/b15-6+ |
| InChIKey | JPIIESUDCPIQGY-GIDUJCDVSA-N |
| XLogP | 2.29 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one?
The IUPAC name of 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one (CID 143018685) is 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one.
What is the SMILES notation for 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one?
The canonical SMILES for 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one is [H]/N=C/C(=O)c1cc(=O)c2cc(C)c(C)c(C)c2[nH]1.
What is the InChIKey of 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one?
The InChIKey is JPIIESUDCPIQGY-GIDUJCDVSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-7-4-10-12(17)5-11(13(18)6-15)16-14(10)9(3)8(7)2/h4-6,15H,1-3H3,(H,16,17)/b15-6+.
What are the key properties of 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one?
2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one has a molecular weight of 242.28 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iminoacetyl)-6,7,8-trimethyl-1H-quinolin-4-one is sourced from PubChem (CID 143018685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).