C20H29N — CID 143019351
N-[(1E)-2-[(3E)-3-[(Z)-but-2-enylidene]-4-methylcyclohexa-1,5-dien-1-yl]buta-1,3-dienyl]propan-2-imine;ethane (PubChem CID 143019351) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is N-[(1E)-2-[(3E)-3-[(Z)-but-2-enylidene]-4-methylcyclohexa-1,5-dien-1-yl]buta-1,3-dienyl]propan-2-imine;ethane.
| Compound Name | N-[(1E)-2-[(3E)-3-[(Z)-but-2-enylidene]-4-methylcyclohexa-1,5-dien-1-yl]buta-1,3-dienyl]propan-2-imine;ethane |
|---|---|
| PubChem CID | 143019351 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-[(1E)-2-[(3E)-3-[(Z)-but-2-enylidene]-4-methylcyclohexa-1,5-dien-1-yl]buta-1,3-dienyl]propan-2-imine;ethane |
| SMILES | C=C/C(=C\N=C(C)C)C1=C/C(=C/C=C\C)C(C)C=C1.CC |
| InChI | InChI=1S/C18H23N.C2H6/c1-6-8-9-17-12-18(11-10-15(17)5)16(7-2)13-19-14(3)4;1-2/h6-13,15H,2H2,1,3-5H3;1-2H3/b8-6-,16-13+,17-9-; |
| InChIKey | OSGDOWPQCCRBNZ-RBQHXCDPSA-N |
| XLogP | 6.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|