C8H14N2 — CID 143019501
5-methyl-2-propyl-1,2-dihydropyrimidine (PubChem CID 143019501) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-methyl-2-propyl-1,2-dihydropyrimidine.
| Compound Name | 5-methyl-2-propyl-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 143019501 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 5-methyl-2-propyl-1,2-dihydropyrimidine |
| SMILES | CCCC1N=CC(C)=CN1 |
| InChI | InChI=1S/C8H14N2/c1-3-4-8-9-5-7(2)6-10-8/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | QNDIBSHXBJBBHN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |