C20H20N2O — CID 143019566
(E)-3-[1-ethyl-2-(2-phenylethyl)benzimidazol-5-yl]prop-2-enal (PubChem CID 143019566) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (E)-3-[1-ethyl-2-(2-phenylethyl)benzimidazol-5-yl]prop-2-enal.
| Compound Name | (E)-3-[1-ethyl-2-(2-phenylethyl)benzimidazol-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 143019566 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (E)-3-[1-ethyl-2-(2-phenylethyl)benzimidazol-5-yl]prop-2-enal |
| SMILES | CCn1c(CCc2ccccc2)nc2cc(/C=C/C=O)ccc21 |
| InChI | InChI=1S/C20H20N2O/c1-2-22-19-12-10-17(9-6-14-23)15-18(19)21-20(22)13-11-16-7-4-3-5-8-16/h3-10,12,14-15H,2,11,13H2,1H3/b9-6+ |
| InChIKey | YUWNIPNXRBXWIR-RMKNXTFCSA-N |
| XLogP | 4.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|