C27H30F2N4O2 — CID 143020153
(E)-4-[3-[4-(2,3-difluorophenyl)-1,2-oxazol-5-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(2-ethoxyethyl)hept-4-en-1-amine (PubChem CID 143020153) has the molecular formula C27H30F2N4O2 and a molecular weight of 480.56 g/mol. Its IUPAC name is (E)-4-[3-[4-(2,3-difluorophenyl)-1,2-oxazol-5-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(2-ethoxyethyl)hept-4-en-1-amine.
| Compound Name | (E)-4-[3-[4-(2,3-difluorophenyl)-1,2-oxazol-5-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(2-ethoxyethyl)hept-4-en-1-amine |
|---|---|
| PubChem CID | 143020153 |
| Molecular Formula | C27H30F2N4O2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (E)-4-[3-[4-(2,3-difluorophenyl)-1,2-oxazol-5-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(2-ethoxyethyl)hept-4-en-1-amine |
| SMILES | CC/C=C(\CCCNCCOCC)c1cnc2[nH]cc(-c3oncc3-c3cccc(F)c3F)c2c1 |
| InChI | InChI=1S/C27H30F2N4O2/c1-3-7-18(8-6-11-30-12-13-34-4-2)19-14-21-22(16-32-27(21)31-15-19)26-23(17-33-35-26)20-9-5-10-24(28)25(20)29/h5,7,9-10,14-17,30H,3-4,6,8,11-13H2,1-2H3,(H,31,32)/b18-7+ |
| InChIKey | NZWAVIIMBLRGPE-CNHKJKLMSA-N |
| XLogP | 6.36 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|