About ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one
ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one (PubChem CID 143020768) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one |
| PubChem CID | 143020768 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one |
| SMILES | C=C(O)C(=O)/C=C\NC.CC |
| InChI | InChI=1S/C6H9NO2.C2H6/c1-5(8)6(9)3-4-7-2;1-2/h3-4,7-8H,1H2,2H3;1-2H3/b4-3-; |
| InChIKey | LCBXENMPANGIOQ-LNKPDPKZSA-N |
| XLogP | 1.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one?
The IUPAC name of ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one (CID 143020768) is ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one.
What is the SMILES notation for ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one?
The canonical SMILES for ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one is C=C(O)C(=O)/C=C\NC.CC.
What is the InChIKey of ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one?
The InChIKey is LCBXENMPANGIOQ-LNKPDPKZSA-N. The full InChI is InChI=1S/C6H9NO2.C2H6/c1-5(8)6(9)3-4-7-2;1-2/h3-4,7-8H,1H2,2H3;1-2H3/b4-3-;.
What are the key properties of ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one?
ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one has a molecular weight of 157.21 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z)-4-hydroxy-1-(methylamino)penta-1,4-dien-3-one is sourced from PubChem (CID 143020768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).