C41H60O8 — CID 143020915
(2E,4E)-7-(20-ethyl-12,21-dihydroxy-7,10,15,21-tetramethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl)-3,4-dimethyl-1-phenylhepta-2,4-dien-1-one (PubChem CID 143020915) has the molecular formula C41H60O8 and a molecular weight of 680.92 g/mol. Its IUPAC name is (2E,4E)-7-(20-ethyl-12,21-dihydroxy-7,10,15,21-tetramethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl)-3,4-dimethyl-1-phenylhepta-2,4-dien-1-one.
| Compound Name | (2E,4E)-7-(20-ethyl-12,21-dihydroxy-7,10,15,21-tetramethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl)-3,4-dimethyl-1-phenylhepta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143020915 |
| Molecular Formula | C41H60O8 |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | (2E,4E)-7-(20-ethyl-12,21-dihydroxy-7,10,15,21-tetramethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl)-3,4-dimethyl-1-phenylhepta-2,4-dien-1-one |
| SMILES | CCC1OC2CCC3(C)OC4C(O)CC5(C)OC(CC/C=C(C)/C(C)=C/C(=O)c6ccccc6)C(C)CC5OC4CC3OC2CCC1(C)O |
| InChI | InChI=1S/C41H60O8/c1-8-35-39(5,44)19-17-32-33(45-35)18-20-40(6)37(46-32)23-34-38(49-40)30(43)24-41(7)36(47-34)22-27(4)31(48-41)16-12-13-25(2)26(3)21-29(42)28-14-10-9-11-15-28/h9-11,13-15,21,27,30-38,43-44H,8,12,16-20,22-24H2,1-7H3/b25-13+,26-21+ |
| InChIKey | WWYBFILJCFVURA-LPUPHVAQSA-N |
| XLogP | 7.05 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|