C44H68O8 — CID 143020929
5-(7-but-3-enyl-2-ethyl-6-hydroxy-6-methyloxepan-3-yl)oxy-13-[(3E,5E)-7-hydroxy-4,5-dimethyl-7-phenylhepta-3,5-dienyl]-6,6,11,14-tetramethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-9-ol (PubChem CID 143020929) has the molecular formula C44H68O8 and a molecular weight of 725.02 g/mol. Its IUPAC name is 5-(7-but-3-enyl-2-ethyl-6-hydroxy-6-methyloxepan-3-yl)oxy-13-[(3E,5E)-7-hydroxy-4,5-dimethyl-7-phenylhepta-3,5-dienyl]-6,6,11,14-tetramethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-9-ol.
| Compound Name | 5-(7-but-3-enyl-2-ethyl-6-hydroxy-6-methyloxepan-3-yl)oxy-13-[(3E,5E)-7-hydroxy-4,5-dimethyl-7-phenylhepta-3,5-dienyl]-6,6,11,14-tetramethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-9-ol |
|---|---|
| PubChem CID | 143020929 |
| Molecular Formula | C44H68O8 |
| Molecular Weight | 725.02 g/mol |
| Exact Mass | 724.49 |
| IUPAC Name | 5-(7-but-3-enyl-2-ethyl-6-hydroxy-6-methyloxepan-3-yl)oxy-13-[(3E,5E)-7-hydroxy-4,5-dimethyl-7-phenylhepta-3,5-dienyl]-6,6,11,14-tetramethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-9-ol |
| SMILES | C=CCCC1OC(CC)C(OC2CC3OC4CC(C)C(CC/C=C(C)/C(C)=C/C(O)c5ccccc5)OC4(C)CC(O)C3OC2(C)C)CCC1(C)O |
| InChI | InChI=1S/C44H68O8/c1-10-12-21-38-43(8,47)23-22-36(34(11-2)48-38)49-39-26-37-41(52-42(39,6)7)33(46)27-44(9)40(50-37)25-30(5)35(51-44)20-16-17-28(3)29(4)24-32(45)31-18-14-13-15-19-31/h10,13-15,17-19,24,30,32-41,45-47H,1,11-12,16,20-23,25-27H2,2-9H3/b28-17+,29-24+ |
| InChIKey | BWTSLHZGWIJGQQ-AUCMDUDOSA-N |
| XLogP | 8.09 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.02 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|