About ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione
ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione (PubChem CID 143021033) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione.
Molecular Properties
| Compound Name | ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione |
| PubChem CID | 143021033 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione |
| SMILES | C=C.Cc1cnc2c(n1)C(=O)OC2=O |
| InChI | InChI=1S/C7H4N2O3.C2H4/c1-3-2-8-4-5(9-3)7(11)12-6(4)10;1-2/h2H,1H3;1-2H2 |
| InChIKey | KTVMFCOFMXPQGI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione?
The IUPAC name of ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione (CID 143021033) is ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione.
What is the SMILES notation for ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione?
The canonical SMILES for ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione is C=C.Cc1cnc2c(n1)C(=O)OC2=O.
What is the InChIKey of ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione?
The InChIKey is KTVMFCOFMXPQGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3.C2H4/c1-3-2-8-4-5(9-3)7(11)12-6(4)10;1-2/h2H,1H3;1-2H2.
What are the key properties of ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione?
ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione has a molecular weight of 192.17 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-methylfuro[3,4-b]pyrazine-5,7-dione is sourced from PubChem (CID 143021033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).