About 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile
4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile (PubChem CID 14302201) has the molecular formula C19H21Cl2NO2
and a molecular weight of 366.29 g/mol. Its IUPAC name is 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile.
Molecular Properties
| Compound Name | 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile |
| PubChem CID | 14302201 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile |
| SMILES | CC1(C2CCCC2)Cc2cc(OCCCC#N)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C19H21Cl2NO2/c1-19(13-6-2-3-7-13)11-12-10-14(24-9-5-4-8-22)16(20)17(21)15(12)18(19)23/h10,13H,2-7,9,11H2,1H3 |
| InChIKey | XPBNQUXLZGMMHD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile?
The IUPAC name of 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile (CID 14302201) is 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile.
What is the SMILES notation for 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile?
The canonical SMILES for 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile is CC1(C2CCCC2)Cc2cc(OCCCC#N)c(Cl)c(Cl)c2C1=O.
What is the InChIKey of 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile?
The InChIKey is XPBNQUXLZGMMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2NO2/c1-19(13-6-2-3-7-13)11-12-10-14(24-9-5-4-8-22)16(20)17(21)15(12)18(19)23/h10,13H,2-7,9,11H2,1H3.
What are the key properties of 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile?
4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile has a molecular weight of 366.29 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)oxy]butanenitrile is sourced from PubChem (CID 14302201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).