About (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine
(2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine (PubChem CID 143022568) has the molecular formula C14H10F3N
and a molecular weight of 249.24 g/mol. Its IUPAC name is (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine.
Molecular Properties
| Compound Name | (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine |
| PubChem CID | 143022568 |
| Molecular Formula | C14H10F3N |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine |
| SMILES | [H]/N=C(\c1ccccc1C)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H10F3N/c1-8-4-2-3-5-10(8)14(18)13-11(16)6-9(15)7-12(13)17/h2-7,18H,1H3/b18-14+ |
| InChIKey | MUJRDSKGNWLRJW-NBVRZTHBSA-N |
| XLogP | 3.83 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine?
The IUPAC name of (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine (CID 143022568) is (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine.
What is the SMILES notation for (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine?
The canonical SMILES for (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine is [H]/N=C(\c1ccccc1C)c1c(F)cc(F)cc1F.
What is the InChIKey of (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine?
The InChIKey is MUJRDSKGNWLRJW-NBVRZTHBSA-N. The full InChI is InChI=1S/C14H10F3N/c1-8-4-2-3-5-10(8)14(18)13-11(16)6-9(15)7-12(13)17/h2-7,18H,1H3/b18-14+.
What are the key properties of (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine?
(2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine has a molecular weight of 249.24 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)-(2,4,6-trifluorophenyl)methanimine is sourced from PubChem (CID 143022568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).