C25H46N4O3 — CID 143023918
(E)-N-(3-hydroxypropyl)-2-methyl-5-[methyl-[3-methyl-2-[1-(1-propan-2-ylpiperidin-2-yl)ethenylamino]butanoyl]amino]pent-2-enamide (PubChem CID 143023918) has the molecular formula C25H46N4O3 and a molecular weight of 450.67 g/mol. Its IUPAC name is (E)-N-(3-hydroxypropyl)-2-methyl-5-[methyl-[3-methyl-2-[1-(1-propan-2-ylpiperidin-2-yl)ethenylamino]butanoyl]amino]pent-2-enamide.
| Compound Name | (E)-N-(3-hydroxypropyl)-2-methyl-5-[methyl-[3-methyl-2-[1-(1-propan-2-ylpiperidin-2-yl)ethenylamino]butanoyl]amino]pent-2-enamide |
|---|---|
| PubChem CID | 143023918 |
| Molecular Formula | C25H46N4O3 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | (E)-N-(3-hydroxypropyl)-2-methyl-5-[methyl-[3-methyl-2-[1-(1-propan-2-ylpiperidin-2-yl)ethenylamino]butanoyl]amino]pent-2-enamide |
| SMILES | C=C(NC(C(=O)N(C)CC/C=C(\C)C(=O)NCCCO)C(C)C)C1CCCCN1C(C)C |
| InChI | InChI=1S/C25H46N4O3/c1-18(2)23(27-21(6)22-13-8-9-16-29(22)19(3)4)25(32)28(7)15-10-12-20(5)24(31)26-14-11-17-30/h12,18-19,22-23,27,30H,6,8-11,13-17H2,1-5,7H3,(H,26,31)/b20-12+ |
| InChIKey | BXMIDVDWRUXSSQ-UDWIEESQSA-N |
| XLogP | 2.67 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|