About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 14302448) has the molecular formula C21H23FO4
and a molecular weight of 358.41 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| PubChem CID | 14302448 |
| Molecular Formula | C21H23FO4 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC(C(=O)OCC1COC(C)(C)O1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C21H23FO4/c1-14(20(23)24-12-17-13-25-21(2,3)26-17)16-9-10-18(19(22)11-16)15-7-5-4-6-8-15/h4-11,14,17H,12-13H2,1-3H3 |
| InChIKey | IFYIHUNZBIUOLR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate (CID 14302448) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate is CC(C(=O)OCC1COC(C)(C)O1)c1ccc(-c2ccccc2)c(F)c1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate?
The InChIKey is IFYIHUNZBIUOLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FO4/c1-14(20(23)24-12-17-13-25-21(2,3)26-17)16-9-10-18(19(22)11-16)15-7-5-4-6-8-15/h4-11,14,17H,12-13H2,1-3H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate has a molecular weight of 358.41 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(3-fluoro-4-phenylphenyl)propanoate is sourced from PubChem (CID 14302448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).