About 1-ethylpyridine-4-thione
1-ethylpyridine-4-thione (PubChem CID 14302455) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 1-ethylpyridine-4-thione.
Molecular Properties
| Compound Name | 1-ethylpyridine-4-thione |
| PubChem CID | 14302455 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 1-ethylpyridine-4-thione |
| SMILES | CCn1ccc(=S)cc1 |
| InChI | InChI=1S/C7H9NS/c1-2-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| InChIKey | UEJVBEPNUJYJDF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridine-4-thione?
The IUPAC name of 1-ethylpyridine-4-thione (CID 14302455) is 1-ethylpyridine-4-thione.
What is the SMILES notation for 1-ethylpyridine-4-thione?
The canonical SMILES for 1-ethylpyridine-4-thione is CCn1ccc(=S)cc1.
What is the InChIKey of 1-ethylpyridine-4-thione?
The InChIKey is UEJVBEPNUJYJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS/c1-2-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3.
What are the key properties of 1-ethylpyridine-4-thione?
1-ethylpyridine-4-thione has a molecular weight of 139.22 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridine-4-thione is sourced from PubChem (CID 14302455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).