C22H28F4N2O3 — CID 143024570
(2E,4Z)-5-amino-9-(5-fluoro-2-methylphenyl)-7-hydroxy-N-(1-hydroxyethenyl)-3,9-dimethyl-7-(trifluoromethyl)deca-2,4-dienamide (PubChem CID 143024570) has the molecular formula C22H28F4N2O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is (2E,4Z)-5-amino-9-(5-fluoro-2-methylphenyl)-7-hydroxy-N-(1-hydroxyethenyl)-3,9-dimethyl-7-(trifluoromethyl)deca-2,4-dienamide.
| Compound Name | (2E,4Z)-5-amino-9-(5-fluoro-2-methylphenyl)-7-hydroxy-N-(1-hydroxyethenyl)-3,9-dimethyl-7-(trifluoromethyl)deca-2,4-dienamide |
|---|---|
| PubChem CID | 143024570 |
| Molecular Formula | C22H28F4N2O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2E,4Z)-5-amino-9-(5-fluoro-2-methylphenyl)-7-hydroxy-N-(1-hydroxyethenyl)-3,9-dimethyl-7-(trifluoromethyl)deca-2,4-dienamide |
| SMILES | C=C(O)NC(=O)/C=C(C)/C=C(\N)CC(O)(CC(C)(C)c1cc(F)ccc1C)C(F)(F)F |
| InChI | InChI=1S/C22H28F4N2O3/c1-13(9-19(30)28-15(3)29)8-17(27)11-21(31,22(24,25)26)12-20(4,5)18-10-16(23)7-6-14(18)2/h6-10,29,31H,3,11-12,27H2,1-2,4-5H3,(H,28,30)/b13-9+,17-8- |
| InChIKey | XMMNLTYYXFPTHI-KMVWJNANSA-N |
| XLogP | 4.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|