C20H22ClF3N2O — CID 143024743
(5E,7E)-7-chloro-5-ethenyl-1,1,1-trifluoro-4-methyl-2-(1H-pyrrolo[2,3-c]pyridin-2-ylmethyl)nona-5,7-dien-2-ol (PubChem CID 143024743) has the molecular formula C20H22ClF3N2O and a molecular weight of 398.86 g/mol. Its IUPAC name is (5E,7E)-7-chloro-5-ethenyl-1,1,1-trifluoro-4-methyl-2-(1H-pyrrolo[2,3-c]pyridin-2-ylmethyl)nona-5,7-dien-2-ol.
| Compound Name | (5E,7E)-7-chloro-5-ethenyl-1,1,1-trifluoro-4-methyl-2-(1H-pyrrolo[2,3-c]pyridin-2-ylmethyl)nona-5,7-dien-2-ol |
|---|---|
| PubChem CID | 143024743 |
| Molecular Formula | C20H22ClF3N2O |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (5E,7E)-7-chloro-5-ethenyl-1,1,1-trifluoro-4-methyl-2-(1H-pyrrolo[2,3-c]pyridin-2-ylmethyl)nona-5,7-dien-2-ol |
| SMILES | C=C/C(=C\C(Cl)=C/C)C(C)CC(O)(Cc1cc2ccncc2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C20H22ClF3N2O/c1-4-14(8-16(21)5-2)13(3)10-19(27,20(22,23)24)11-17-9-15-6-7-25-12-18(15)26-17/h4-9,12-13,26-27H,1,10-11H2,2-3H3/b14-8+,16-5+ |
| InChIKey | ISNXGQRYYPATOU-QZIHHSKTSA-N |
| XLogP | 5.68 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|