C24H38O4 — CID 143024812
2-[(2R,6R)-2-[(E,2S)-10-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methyl-4-methylidenedec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde (PubChem CID 143024812) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[(2R,6R)-2-[(E,2S)-10-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methyl-4-methylidenedec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,6R)-2-[(E,2S)-10-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methyl-4-methylidenedec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 143024812 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[(2R,6R)-2-[(E,2S)-10-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methyl-4-methylidenedec-7-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde |
| SMILES | C=C(CC/C=C/CCC1COC(C)(C)O1)C[C@H](C)C[C@@H]1CC=C[C@@H](CC=O)O1 |
| InChI | InChI=1S/C24H38O4/c1-19(10-7-5-6-8-11-23-18-26-24(3,4)28-23)16-20(2)17-22-13-9-12-21(27-22)14-15-25/h5-6,9,12,15,20-23H,1,7-8,10-11,13-14,16-18H2,2-4H3/b6-5+/t20-,21-,22-,23?/m0/s1 |
| InChIKey | WZOCLMRJACNQBM-PHQJMURTSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|