C30H42O6 — CID 143024841
(1R,3Z)-8-[(1E)-3-methoxy-5-methylhexa-1,5-dienyl]-16-methyl-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione (PubChem CID 143024841) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is (1R,3Z)-8-[(1E)-3-methoxy-5-methylhexa-1,5-dienyl]-16-methyl-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione.
| Compound Name | (1R,3Z)-8-[(1E)-3-methoxy-5-methylhexa-1,5-dienyl]-16-methyl-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione |
|---|---|
| PubChem CID | 143024841 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (1R,3Z)-8-[(1E)-3-methoxy-5-methylhexa-1,5-dienyl]-16-methyl-14-methylidene-6,9,22-trioxatricyclo[16.3.1.17,10]tricosa-3,20-diene-5,12-dione |
| SMILES | C=C(C)CC(/C=C/C1OC2CC(=O)CC(=C)CC(C)CC3CC=C[C@@H](C/C=C\C(=O)OC1C2)O3)OC |
| InChI | InChI=1S/C30H42O6/c1-20(2)14-25(33-5)12-13-28-29-19-27(35-28)18-23(31)16-21(3)15-22(4)17-26-10-6-8-24(34-26)9-7-11-30(32)36-29/h6-8,11-13,22,24-29H,1,3,9-10,14-19H2,2,4-5H3/b11-7-,13-12+/t22?,24-,25?,26?,27?,28?,29?/m0/s1 |
| InChIKey | FSKQBLCNCWBPFC-ACVATWDVSA-N |
| XLogP | 5.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|