C24H38O5 — CID 143024845
[(E)-12-(3,6-dihydro-2H-pyran-2-yl)-1,7-dihydroxy-2,11-dimethyl-9-methylidenedodec-5-en-3-yl] (Z)-but-2-enoate (PubChem CID 143024845) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(E)-12-(3,6-dihydro-2H-pyran-2-yl)-1,7-dihydroxy-2,11-dimethyl-9-methylidenedodec-5-en-3-yl] (Z)-but-2-enoate.
| Compound Name | [(E)-12-(3,6-dihydro-2H-pyran-2-yl)-1,7-dihydroxy-2,11-dimethyl-9-methylidenedodec-5-en-3-yl] (Z)-but-2-enoate |
|---|---|
| PubChem CID | 143024845 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(E)-12-(3,6-dihydro-2H-pyran-2-yl)-1,7-dihydroxy-2,11-dimethyl-9-methylidenedodec-5-en-3-yl] (Z)-but-2-enoate |
| SMILES | C=C(CC(O)/C=C/CC(OC(=O)/C=C\C)C(C)CO)CC(C)CC1CC=CCO1 |
| InChI | InChI=1S/C24H38O5/c1-5-9-24(27)29-23(20(4)17-25)12-8-10-21(26)15-18(2)14-19(3)16-22-11-6-7-13-28-22/h5-10,19-23,25-26H,2,11-17H2,1,3-4H3/b9-5-,10-8+ |
| InChIKey | QRESALLRBDNUFJ-APQBBXBWSA-N |
| XLogP | 4.12 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|