About 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine (PubChem CID 143025769) has the molecular formula C18H25FN2
and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine |
| PubChem CID | 143025769 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine |
| SMILES | FC1C=CC=CC1N1CCN(CC2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C18H25FN2/c19-17-3-1-2-4-18(17)21-9-7-20(8-10-21)13-16-12-14-5-6-15(16)11-14/h1-6,14-18H,7-13H2 |
| InChIKey | PXPDKLUZOHGTGT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine?
The IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine (CID 143025769) is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine.
What is the SMILES notation for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine?
The canonical SMILES for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine is FC1C=CC=CC1N1CCN(CC2CC3C=CC2C3)CC1.
What is the InChIKey of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine?
The InChIKey is PXPDKLUZOHGTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25FN2/c19-17-3-1-2-4-18(17)21-9-7-20(8-10-21)13-16-12-14-5-6-15(16)11-14/h1-6,14-18H,7-13H2.
What are the key properties of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine?
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine has a molecular weight of 288.41 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-(6-fluorocyclohexa-2,4-dien-1-yl)piperazine is sourced from PubChem (CID 143025769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).