C15H16O3 — CID 143026298
(5Z)-2,2-dimethyl-4-methylidene-5-[(Z)-1-prop-1-en-2-yloxypent-2-en-4-ynylidene]oxolan-3-one (PubChem CID 143026298) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (5Z)-2,2-dimethyl-4-methylidene-5-[(Z)-1-prop-1-en-2-yloxypent-2-en-4-ynylidene]oxolan-3-one.
| Compound Name | (5Z)-2,2-dimethyl-4-methylidene-5-[(Z)-1-prop-1-en-2-yloxypent-2-en-4-ynylidene]oxolan-3-one |
|---|---|
| PubChem CID | 143026298 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (5Z)-2,2-dimethyl-4-methylidene-5-[(Z)-1-prop-1-en-2-yloxypent-2-en-4-ynylidene]oxolan-3-one |
| SMILES | C#C/C=C\C(OC(=C)C)=C1\OC(C)(C)C(=O)C1=C |
| InChI | InChI=1S/C15H16O3/c1-7-8-9-12(17-10(2)3)13-11(4)14(16)15(5,6)18-13/h1,8-9H,2,4H2,3,5-6H3/b9-8-,13-12- |
| InChIKey | GBEIVIISLWTBPB-OZKAYXIQSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|