C20H20N6S — CID 143026631
2-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-6-thiophen-2-yl-1H-benzimidazole (PubChem CID 143026631) has the molecular formula C20H20N6S and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-6-thiophen-2-yl-1H-benzimidazole.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-6-thiophen-2-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 143026631 |
| Molecular Formula | C20H20N6S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-6-thiophen-2-yl-1H-benzimidazole |
| SMILES | CN1CCN(c2ncc(-c3nc4ccc(-c5cccs5)cc4[nH]3)cn2)CC1 |
| InChI | InChI=1S/C20H20N6S/c1-25-6-8-26(9-7-25)20-21-12-15(13-22-20)19-23-16-5-4-14(11-17(16)24-19)18-3-2-10-27-18/h2-5,10-13H,6-9H2,1H3,(H,23,24) |
| InChIKey | JRPUBPHNSBSGGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |