C17H22 — CID 143026644
1,3-dimethyl-2-[(4Z,6E)-2-methylocta-2,4,6-trien-3-yl]benzene (PubChem CID 143026644) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(4Z,6E)-2-methylocta-2,4,6-trien-3-yl]benzene.
| Compound Name | 1,3-dimethyl-2-[(4Z,6E)-2-methylocta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 143026644 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,3-dimethyl-2-[(4Z,6E)-2-methylocta-2,4,6-trien-3-yl]benzene |
| SMILES | C/C=C/C=C\C(=C(C)C)c1c(C)cccc1C |
| InChI | InChI=1S/C17H22/c1-6-7-8-12-16(13(2)3)17-14(4)10-9-11-15(17)5/h6-12H,1-5H3/b7-6+,12-8- |
| InChIKey | WSFGPRJSEFWYDO-KWUPLBGHSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|