C29H43N7O5 — CID 143027403
(11S)-8-amino-11-(3-aminopropyl)-N-(2,5-diaminopentyl)-5,18-dihydroxy-9,12-dioxo-10,13-diazatricyclo[14.4.1.12,6]docosa-1(21),2(22),3,5,16,19-hexaene-14-carboxamide (PubChem CID 143027403) has the molecular formula C29H43N7O5 and a molecular weight of 569.71 g/mol. Its IUPAC name is (11S)-8-amino-11-(3-aminopropyl)-N-(2,5-diaminopentyl)-5,18-dihydroxy-9,12-dioxo-10,13-diazatricyclo[14.4.1.12,6]docosa-1(21),2(22),3,5,16,19-hexaene-14-carboxamide.
| Compound Name | (11S)-8-amino-11-(3-aminopropyl)-N-(2,5-diaminopentyl)-5,18-dihydroxy-9,12-dioxo-10,13-diazatricyclo[14.4.1.12,6]docosa-1(21),2(22),3,5,16,19-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 143027403 |
| Molecular Formula | C29H43N7O5 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | (11S)-8-amino-11-(3-aminopropyl)-N-(2,5-diaminopentyl)-5,18-dihydroxy-9,12-dioxo-10,13-diazatricyclo[14.4.1.12,6]docosa-1(21),2(22),3,5,16,19-hexaene-14-carboxamide |
| SMILES | NCCCC(N)CNC(=O)C1CC2=CC(O)C=CC(=C2)c2ccc(O)c(c2)CC(N)C(=O)N[C@@H](CCCN)C(=O)N1 |
| InChI | InChI=1S/C29H43N7O5/c30-9-1-3-21(32)16-34-28(40)25-13-17-11-18(5-7-22(37)12-17)19-6-8-26(38)20(14-19)15-23(33)27(39)35-24(4-2-10-31)29(41)36-25/h5-8,11-12,14,21-25,37-38H,1-4,9-10,13,15-16,30-33H2,(H,34,40)(H,35,39)(H,36,41)/t21?,22?,23?,24-,25?/m0/s1 |
| InChIKey | CIXLFPPKRGSNEO-WWNAGFPVSA-N |
| XLogP | -1.20 |
| TPSA | 231.84 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |