About 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde
4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde (PubChem CID 143027957) has the molecular formula C11H9FO2S
and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde |
| PubChem CID | 143027957 |
| Molecular Formula | C11H9FO2S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde |
| SMILES | C=C/C(F)=C\C(=C)Oc1csc(C=O)c1 |
| InChI | InChI=1S/C11H9FO2S/c1-3-9(12)4-8(2)14-10-5-11(6-13)15-7-10/h3-7H,1-2H2/b9-4+ |
| InChIKey | JBEOGOOOUKJYBG-RUDMXATFSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde?
The IUPAC name of 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde (CID 143027957) is 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde.
What is the SMILES notation for 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde?
The canonical SMILES for 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde is C=C/C(F)=C\C(=C)Oc1csc(C=O)c1.
What is the InChIKey of 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde?
The InChIKey is JBEOGOOOUKJYBG-RUDMXATFSA-N. The full InChI is InChI=1S/C11H9FO2S/c1-3-9(12)4-8(2)14-10-5-11(6-13)15-7-10/h3-7H,1-2H2/b9-4+.
What are the key properties of 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde?
4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde has a molecular weight of 224.26 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]oxythiophene-2-carbaldehyde is sourced from PubChem (CID 143027957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).