C16H20N2O4 — CID 143028100
ethane;3-[(E)-[(4E)-4-ethylidene-1-methyl-2,5-dioxopyrrolidin-3-ylidene]methyl]-1,4-dimethylpyrrole-2,5-dione (PubChem CID 143028100) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethane;3-[(E)-[(4E)-4-ethylidene-1-methyl-2,5-dioxopyrrolidin-3-ylidene]methyl]-1,4-dimethylpyrrole-2,5-dione.
| Compound Name | ethane;3-[(E)-[(4E)-4-ethylidene-1-methyl-2,5-dioxopyrrolidin-3-ylidene]methyl]-1,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 143028100 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethane;3-[(E)-[(4E)-4-ethylidene-1-methyl-2,5-dioxopyrrolidin-3-ylidene]methyl]-1,4-dimethylpyrrole-2,5-dione |
| SMILES | C/C=C1/C(=O)N(C)C(=O)/C1=C/C1=C(C)C(=O)N(C)C1=O.CC |
| InChI | InChI=1S/C14H14N2O4.C2H6/c1-5-8-10(14(20)16(4)12(8)18)6-9-7(2)11(17)15(3)13(9)19;1-2/h5-6H,1-4H3;1-2H3/b8-5+,10-6+; |
| InChIKey | FXFAINCGPRVHTF-JTVRJRSNSA-N |
| XLogP | 1.20 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|