About 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine
3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine (PubChem CID 143028148) has the molecular formula C13H12BNO
and a molecular weight of 209.06 g/mol. Its IUPAC name is 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine.
Molecular Properties
| Compound Name | 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine |
| PubChem CID | 143028148 |
| Molecular Formula | C13H12BNO |
| Molecular Weight | 209.06 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine |
| SMILES | Cc1ccc2c(c1)COB2c1cccnc1 |
| InChI | InChI=1S/C13H12BNO/c1-10-4-5-13-11(7-10)9-16-14(13)12-3-2-6-15-8-12/h2-8H,9H2,1H3 |
| InChIKey | RSAWAPYQZSSEKB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.06 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine?
The IUPAC name of 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine (CID 143028148) is 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine.
What is the SMILES notation for 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine?
The canonical SMILES for 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine is Cc1ccc2c(c1)COB2c1cccnc1.
What is the InChIKey of 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine?
The InChIKey is RSAWAPYQZSSEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BNO/c1-10-4-5-13-11(7-10)9-16-14(13)12-3-2-6-15-8-12/h2-8H,9H2,1H3.
What are the key properties of 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine?
3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine has a molecular weight of 209.06 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-3H-2,1-benzoxaborol-1-yl)pyridine is sourced from PubChem (CID 143028148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).