About ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine
ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 143028391) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 143028391 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC.CC1Cc2cnccc2N1 |
| InChI | InChI=1S/C8H10N2.C2H6/c1-6-4-7-5-9-3-2-8(7)10-6;1-2/h2-3,5-6,10H,4H2,1H3;1-2H3 |
| InChIKey | VYQNHVWDSFIJSA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine (CID 143028391) is ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is CC.CC1Cc2cnccc2N1.
What is the InChIKey of ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is VYQNHVWDSFIJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C2H6/c1-6-4-7-5-9-3-2-8(7)10-6;1-2/h2-3,5-6,10H,4H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 164.25 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 143028391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).