C15H23ClN2O3S — CID 143028613
tert-butyl 3-[[(2Z,4E)-5-chloro-2-sulfanylpenta-2,4-dienoyl]amino]piperidine-1-carboxylate (PubChem CID 143028613) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is tert-butyl 3-[[(2Z,4E)-5-chloro-2-sulfanylpenta-2,4-dienoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2Z,4E)-5-chloro-2-sulfanylpenta-2,4-dienoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143028613 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | tert-butyl 3-[[(2Z,4E)-5-chloro-2-sulfanylpenta-2,4-dienoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)/C(S)=C/C=C/Cl)C1 |
| InChI | InChI=1S/C15H23ClN2O3S/c1-15(2,3)21-14(20)18-9-5-6-11(10-18)17-13(19)12(22)7-4-8-16/h4,7-8,11,22H,5-6,9-10H2,1-3H3,(H,17,19)/b8-4+,12-7- |
| InChIKey | RSWCDAYJBZACRL-LLZLKJDISA-N |
| XLogP | 3.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|