About N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane
N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane (PubChem CID 143028682) has the molecular formula C24H50N2O4
and a molecular weight of 430.67 g/mol. Its IUPAC name is N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane.
Molecular Properties
| Compound Name | N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane |
| PubChem CID | 143028682 |
| Molecular Formula | C24H50N2O4 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane |
| SMILES | CC(C)C(=O)O.CCCCC.CCCCCC(=O)NC(C)CC(=O)NC(C)(C)CC |
| InChI | InChI=1S/C15H30N2O2.C5H12.C4H8O2/c1-6-8-9-10-13(18)16-12(3)11-14(19)17-15(4,5)7-2;1-3-5-4-2;1-3(2)4(5)6/h12H,6-11H2,1-5H3,(H,16,18)(H,17,19);3-5H2,1-2H3;3H,1-2H3,(H,5,6) |
| InChIKey | WAVMWCBYNLPFOV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane?
The IUPAC name of N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane (CID 143028682) is N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane.
What is the SMILES notation for N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane?
The canonical SMILES for N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane is CC(C)C(=O)O.CCCCC.CCCCCC(=O)NC(C)CC(=O)NC(C)(C)CC.
What is the InChIKey of N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane?
The InChIKey is WAVMWCBYNLPFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2.C5H12.C4H8O2/c1-6-8-9-10-13(18)16-12(3)11-14(19)17-15(4,5)7-2;1-3-5-4-2;1-3(2)4(5)6/h12H,6-11H2,1-5H3,(H,16,18)(H,17,19);3-5H2,1-2H3;3H,1-2H3,(H,5,6).
What are the key properties of N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane?
N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane has a molecular weight of 430.67 g/mol, XLogP of 5.69, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-methylbutan-2-ylamino)-4-oxobutan-2-yl]hexanamide;2-methylpropanoic acid;pentane is sourced from PubChem (CID 143028682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).