C21H21N5O2 — CID 143028728
4-[4-[(2-methylanilino)methylamino]-3-(methylideneamino)phenoxy]pyridine-2-carboxamide (PubChem CID 143028728) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-[4-[(2-methylanilino)methylamino]-3-(methylideneamino)phenoxy]pyridine-2-carboxamide.
| Compound Name | 4-[4-[(2-methylanilino)methylamino]-3-(methylideneamino)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143028728 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 4-[4-[(2-methylanilino)methylamino]-3-(methylideneamino)phenoxy]pyridine-2-carboxamide |
| SMILES | C=Nc1cc(Oc2ccnc(C(N)=O)c2)ccc1NCNc1ccccc1C |
| InChI | InChI=1S/C21H21N5O2/c1-14-5-3-4-6-17(14)25-13-26-18-8-7-15(11-19(18)23-2)28-16-9-10-24-20(12-16)21(22)27/h3-12,25-26H,2,13H2,1H3,(H2,22,27) |
| InChIKey | NHAVBQJAGKRXRB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|