About ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene
ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene (PubChem CID 143029310) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene |
| PubChem CID | 143029310 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene |
| SMILES | CC.CSC1=CC=CCC=C1C |
| InChI | InChI=1S/C9H12S.C2H6/c1-8-6-4-3-5-7-9(8)10-2;1-2/h3,5-7H,4H2,1-2H3;1-2H3 |
| InChIKey | JEFZOWQOIZJWOD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene (CID 143029310) is ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene is CC.CSC1=CC=CCC=C1C.
What is the InChIKey of ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene?
The InChIKey is JEFZOWQOIZJWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S.C2H6/c1-8-6-4-3-5-7-9(8)10-2;1-2/h3,5-7H,4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene?
ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene has a molecular weight of 182.33 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-methylsulfanylcyclohepta-1,3,5-triene is sourced from PubChem (CID 143029310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).