C33H38Cl2N2O3S — CID 143029639
2-(2,4-dichlorophenyl)-N-(3,6-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-methylquinoline-4-carboxamide;methyl acetate;propane (PubChem CID 143029639) has the molecular formula C33H38Cl2N2O3S and a molecular weight of 613.65 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(3,6-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-methylquinoline-4-carboxamide;methyl acetate;propane.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(3,6-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-methylquinoline-4-carboxamide;methyl acetate;propane |
|---|---|
| PubChem CID | 143029639 |
| Molecular Formula | C33H38Cl2N2O3S |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(3,6-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-methylquinoline-4-carboxamide;methyl acetate;propane |
| SMILES | CCC.COC(C)=O.Cc1c(NC(=O)c2c(C)c(-c3ccc(Cl)cc3Cl)nc3ccccc23)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C27H24Cl2N2OS.C3H6O2.C3H8/c1-14-8-10-18-15(2)27(33-23(18)12-14)31-26(32)24-16(3)25(19-11-9-17(28)13-21(19)29)30-22-7-5-4-6-20(22)24;1-3(4)5-2;1-3-2/h4-7,9,11,13-14H,8,10,12H2,1-3H3,(H,31,32);1-2H3;3H2,1-2H3 |
| InChIKey | XWIPPSHPLZCDAI-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |