About ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one
ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one (PubChem CID 143030138) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one.
Molecular Properties
| Compound Name | ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one |
| PubChem CID | 143030138 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one |
| SMILES | CC.CC.CCC1=CC(=O)C=C2N(C)CC3CC123 |
| InChI | InChI=1S/C12H15NO.2C2H6/c1-3-8-4-10(14)5-11-12(8)6-9(12)7-13(11)2;2*1-2/h4-5,9H,3,6-7H2,1-2H3;2*1-2H3 |
| InChIKey | AMBVMGFOCXXVIU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The IUPAC name of ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one (CID 143030138) is ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one.
What is the SMILES notation for ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The canonical SMILES for ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one is CC.CC.CCC1=CC(=O)C=C2N(C)CC3CC123.
What is the InChIKey of ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
The InChIKey is AMBVMGFOCXXVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.2C2H6/c1-3-8-4-10(14)5-11-12(8)6-9(12)7-13(11)2;2*1-2/h4-5,9H,3,6-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one?
ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one has a molecular weight of 249.40 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-3-methyl-1a,2-dihydro-1H-cyclopropa[c]indol-5-one is sourced from PubChem (CID 143030138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).