C28H35N — CID 143030334
3-tert-butyl-5-ethyl-N-[1-[4-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]phenyl]ethenyl]aniline (PubChem CID 143030334) has the molecular formula C28H35N and a molecular weight of 385.60 g/mol. Its IUPAC name is 3-tert-butyl-5-ethyl-N-[1-[4-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]phenyl]ethenyl]aniline.
| Compound Name | 3-tert-butyl-5-ethyl-N-[1-[4-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 143030334 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 3-tert-butyl-5-ethyl-N-[1-[4-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]phenyl]ethenyl]aniline |
| SMILES | C=C/C=C\C(C)=C(/C)c1ccc(C(=C)Nc2cc(CC)cc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C28H35N/c1-9-11-12-20(3)21(4)24-13-15-25(16-14-24)22(5)29-27-18-23(10-2)17-26(19-27)28(6,7)8/h9,11-19,29H,1,5,10H2,2-4,6-8H3/b12-11-,21-20+ |
| InChIKey | LNBBYORYEYAJDI-BHCBCLADSA-N |
| XLogP | 8.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|