C16H15Br3N2O5 — CID 143030488
2-(4-bromo-2-methoxyphenoxy)-N'-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]acetohydrazide (PubChem CID 143030488) has the molecular formula C16H15Br3N2O5 and a molecular weight of 555.02 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-N'-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]acetohydrazide.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-N'-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]acetohydrazide |
|---|---|
| PubChem CID | 143030488 |
| Molecular Formula | C16H15Br3N2O5 |
| Molecular Weight | 555.02 g/mol |
| Exact Mass | 551.85 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-N'-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]acetohydrazide |
| SMILES | COc1cc(Br)ccc1OCC(=O)NNCc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C16H15Br3N2O5/c1-25-12-5-9(17)2-3-11(12)26-7-13(23)21-20-6-8-4-10(22)16(24)15(19)14(8)18/h2-5,20,22,24H,6-7H2,1H3,(H,21,23) |
| InChIKey | QTLPTSMPWWWYBA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.02 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|