C17H26F2N6O3S — CID 143030687
N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[3-(methoxymethyl)-4-oxoimidazolidin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane (PubChem CID 143030687) has the molecular formula C17H26F2N6O3S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[3-(methoxymethyl)-4-oxoimidazolidin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane.
| Compound Name | N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[3-(methoxymethyl)-4-oxoimidazolidin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane |
|---|---|
| PubChem CID | 143030687 |
| Molecular Formula | C17H26F2N6O3S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[3-(methoxymethyl)-4-oxoimidazolidin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane |
| SMILES | COC.COCN1CN(c2c(F)cc(N(N)/C=C(\N)CNC=S)cc2F)CC1=O |
| InChI | InChI=1S/C15H20F2N6O2S.C2H6O/c1-25-9-22-8-21(6-14(22)24)15-12(16)2-11(3-13(15)17)23(19)5-10(18)4-20-7-26;1-3-2/h2-3,5,7H,4,6,8-9,18-19H2,1H3,(H,20,26);1-2H3/b10-5-; |
| InChIKey | OKFRBKOMVRNYIW-WIMVAJRLSA-N |
| XLogP | 0.46 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|