About ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine
ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine (PubChem CID 143030913) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine.
Molecular Properties
| Compound Name | ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine |
| PubChem CID | 143030913 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine |
| SMILES | C=C/C=C1/CCNC/C1=C/C.CC.CC |
| InChI | InChI=1S/C10H15N.2C2H6/c1-3-5-10-6-7-11-8-9(10)4-2;2*1-2/h3-5,11H,1,6-8H2,2H3;2*1-2H3/b9-4-,10-5-;; |
| InChIKey | XTVJPRJAKUMOTQ-QHVNCQGVSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine?
The IUPAC name of ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine (CID 143030913) is ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine.
What is the SMILES notation for ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine?
The canonical SMILES for ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine is C=C/C=C1/CCNC/C1=C/C.CC.CC.
What is the InChIKey of ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine?
The InChIKey is XTVJPRJAKUMOTQ-QHVNCQGVSA-N. The full InChI is InChI=1S/C10H15N.2C2H6/c1-3-5-10-6-7-11-8-9(10)4-2;2*1-2/h3-5,11H,1,6-8H2,2H3;2*1-2H3/b9-4-,10-5-;;.
What are the key properties of ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine?
ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine has a molecular weight of 209.38 g/mol, XLogP of 4.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E,4Z)-3-ethylidene-4-prop-2-enylidenepiperidine is sourced from PubChem (CID 143030913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).