C20H17N3O — CID 143030915
1-[4-[5-(1,3-oxazol-5-yl)isoquinolin-6-yl]phenyl]ethanamine (PubChem CID 143030915) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[4-[5-(1,3-oxazol-5-yl)isoquinolin-6-yl]phenyl]ethanamine.
| Compound Name | 1-[4-[5-(1,3-oxazol-5-yl)isoquinolin-6-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 143030915 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[4-[5-(1,3-oxazol-5-yl)isoquinolin-6-yl]phenyl]ethanamine |
| SMILES | CC(N)c1ccc(-c2ccc3cnccc3c2-c2cnco2)cc1 |
| InChI | InChI=1S/C20H17N3O/c1-13(21)14-2-4-15(5-3-14)17-7-6-16-10-22-9-8-18(16)20(17)19-11-23-12-24-19/h2-13H,21H2,1H3 |
| InChIKey | KTFSWMYQRYPBJY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |