C23H31ClN2O — CID 143031080
(6aS)-11-chloro-12-ethoxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-3-amine;ethane (PubChem CID 143031080) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is (6aS)-11-chloro-12-ethoxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-3-amine;ethane.
| Compound Name | (6aS)-11-chloro-12-ethoxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-3-amine;ethane |
|---|---|
| PubChem CID | 143031080 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (6aS)-11-chloro-12-ethoxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-3-amine;ethane |
| SMILES | CC.CCOc1cc2c(cc1Cl)CCN(C)[C@H]1CCc3cc(N)ccc3C21 |
| InChI | InChI=1S/C21H25ClN2O.C2H6/c1-3-25-20-12-17-14(11-18(20)22)8-9-24(2)19-7-4-13-10-15(23)5-6-16(13)21(17)19;1-2/h5-6,10-12,19,21H,3-4,7-9,23H2,1-2H3;1-2H3/t19-,21?;/m0./s1 |
| InChIKey | UGCBPDREAKCPTK-AUFHPKEVSA-N |
| XLogP | 5.28 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|