About 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea
1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea (PubChem CID 143031263) has the molecular formula C18H31N3O
and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea |
| PubChem CID | 143031263 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea |
| SMILES | C=C/C=C(\C=C/C)C(C)NC(=O)N(CNC)C1CCCCC1 |
| InChI | InChI=1S/C18H31N3O/c1-5-10-16(11-6-2)15(3)20-18(22)21(14-19-4)17-12-8-7-9-13-17/h5-6,10-11,15,17,19H,1,7-9,12-14H2,2-4H3,(H,20,22)/b11-6-,16-10+ |
| InChIKey | ROQBCMFCSYHJDI-WJYDFUCJSA-N |
| XLogP | 3.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea?
The IUPAC name of 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea (CID 143031263) is 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea.
What is the SMILES notation for 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea?
The canonical SMILES for 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea is C=C/C=C(\C=C/C)C(C)NC(=O)N(CNC)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea?
The InChIKey is ROQBCMFCSYHJDI-WJYDFUCJSA-N. The full InChI is InChI=1S/C18H31N3O/c1-5-10-16(11-6-2)15(3)20-18(22)21(14-19-4)17-12-8-7-9-13-17/h5-6,10-11,15,17,19H,1,7-9,12-14H2,2-4H3,(H,20,22)/b11-6-,16-10+.
What are the key properties of 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea?
1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea has a molecular weight of 305.47 g/mol, XLogP of 3.58, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-1-(methylaminomethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]urea is sourced from PubChem (CID 143031263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).