C18H34N2O3 — CID 143031672
tert-butyl (4R)-4-[(E)-6-amino-4-methylhept-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 143031672) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(E)-6-amino-4-methylhept-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(E)-6-amino-4-methylhept-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 143031672 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | tert-butyl (4R)-4-[(E)-6-amino-4-methylhept-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(N)CC(C)/C=C/C[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-13(11-14(2)19)9-8-10-15-12-22-18(6,7)20(15)16(21)23-17(3,4)5/h8-9,13-15H,10-12,19H2,1-7H3/b9-8+/t13?,14?,15-/m1/s1 |
| InChIKey | AGGKGYYRJARTTO-KFZSDBMLSA-N |
| XLogP | 3.68 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|