C17H12ClN3O2 — CID 143032820
5-(3-chloro-2-pyridinyl)-N-(3-hydroxyphenyl)pyridine-2-carboxamide (PubChem CID 143032820) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 5-(3-chloro-2-pyridinyl)-N-(3-hydroxyphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(3-chloro-2-pyridinyl)-N-(3-hydroxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143032820 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-(3-chloro-2-pyridinyl)-N-(3-hydroxyphenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc(-c2ncccc2Cl)cn1 |
| InChI | InChI=1S/C17H12ClN3O2/c18-14-5-2-8-19-16(14)11-6-7-15(20-10-11)17(23)21-12-3-1-4-13(22)9-12/h1-10,22H,(H,21,23) |
| InChIKey | AJFOEENWRPZKJN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |