C28H25F6N2NaO2 — CID 143033813
sodium;1-[3-amino-5-(2-methylcyclopenten-1-yl)phenyl]ethenolate;3-methyl-5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]pyridine (PubChem CID 143033813) has the molecular formula C28H25F6N2NaO2 and a molecular weight of 558.50 g/mol. Its IUPAC name is sodium;1-[3-amino-5-(2-methylcyclopenten-1-yl)phenyl]ethenolate;3-methyl-5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]pyridine.
| Compound Name | sodium;1-[3-amino-5-(2-methylcyclopenten-1-yl)phenyl]ethenolate;3-methyl-5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 143033813 |
| Molecular Formula | C28H25F6N2NaO2 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | sodium;1-[3-amino-5-(2-methylcyclopenten-1-yl)phenyl]ethenolate;3-methyl-5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]pyridine |
| SMILES | C=C([O-])c1cc(N)cc(C2=C(C)CCC2)c1.Cc1cc(C(F)(F)F)cnc1OCc1cc(F)c(F)cc1F.[Na+] |
| InChI | InChI=1S/C14H9F6NO.C14H17NO.Na/c1-7-2-9(14(18,19)20)5-21-13(7)22-6-8-3-11(16)12(17)4-10(8)15;1-9-4-3-5-14(9)12-6-11(10(2)16)7-13(15)8-12;/h2-5H,6H2,1H3;6-8,16H,2-5,15H2,1H3;/q;;+1/p-1 |
| InChIKey | WZXNRRFBMKTARY-UHFFFAOYSA-M |
| XLogP | 3.97 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|