C28H27BrF3NO — CID 143033890
1-[6-[2-[5-bromo-2-[2-(2,3,6-trifluorophenyl)ethyl]phenyl]cyclopenten-1-yl]-2-pyridinyl]ethenol;ethane (PubChem CID 143033890) has the molecular formula C28H27BrF3NO and a molecular weight of 530.43 g/mol. Its IUPAC name is 1-[6-[2-[5-bromo-2-[2-(2,3,6-trifluorophenyl)ethyl]phenyl]cyclopenten-1-yl]-2-pyridinyl]ethenol;ethane.
| Compound Name | 1-[6-[2-[5-bromo-2-[2-(2,3,6-trifluorophenyl)ethyl]phenyl]cyclopenten-1-yl]-2-pyridinyl]ethenol;ethane |
|---|---|
| PubChem CID | 143033890 |
| Molecular Formula | C28H27BrF3NO |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 1-[6-[2-[5-bromo-2-[2-(2,3,6-trifluorophenyl)ethyl]phenyl]cyclopenten-1-yl]-2-pyridinyl]ethenol;ethane |
| SMILES | C=C(O)c1cccc(C2=C(c3cc(Br)ccc3CCc3c(F)ccc(F)c3F)CCC2)n1.CC |
| InChI | InChI=1S/C26H21BrF3NO.C2H6/c1-15(32)24-6-3-7-25(31-24)19-5-2-4-18(19)21-14-17(27)10-8-16(21)9-11-20-22(28)12-13-23(29)26(20)30;1-2/h3,6-8,10,12-14,32H,1-2,4-5,9,11H2;1-2H3 |
| InChIKey | LOODYEXUTJXPQB-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|